ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Acryloyl chloride |
|
نام محصول | Acryloyl chloride |
نام انگلیسی | Acryloyl chloride;Propenoyl chloride;Acrylyl chloride;prop-2-enoyl chloride;Acyloyl chloride |
میدان مغناطیسی | C3H3OCl |
وزن مولکولی | 90.5083 |
InChI | InChI=1/C3H3ClO/c1-2-3(4)5/h2H,1H2 |
شماره سیایاس | 814-68-6 |
تعداد کمیسیون اروپایی | 212-399-0 |
ساختار مولکولی | |
تراکم | 1.108g/cm3 |
نقطه غلیان | 75.5°C at 760 mmHg |
ضریب شکست | 1.417 |
نقطه اشتعال | 16.1°C |
فشار بخار | 105mmHg at 25°C |
خطر نمادها | F##Highly flammable||C##Corrosive:; |
کدهای خطر | R11##Highly flammable.||R34##Causes burns.:; |
توضیحات ایمنی | S16##Keep away from sources of ignition - No smoking.||S30##Never add water to this product.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |