ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
79-91-4 DL-Terebic acid |
|
نام محصول | DL-Terebic acid |
نام انگلیسی | DL-Terebic acid;Tetrahydro-2,2-dimethyl-5-oxo-3-furancarboxylic acid;Terebicacid;2,2-dimethyl-5-oxotetrahydrofuran-3-carboxylic acid;Terebic acid;(3S)-2,2-dimethyl-5-oxotetrahydrofuran-3-carboxylate;(3R)-2,2-dimethyl-5-oxotetrahydrofuran-3-carboxylate |
میدان مغناطیسی | C7H9O4 |
وزن مولکولی | 157.1445 |
InChI | InChI=1/C7H10O4/c1-7(2)4(6(9)10)3-5(8)11-7/h4H,3H2,1-2H3,(H,9,10)/p-1/t4-/m0/s1 |
شماره سیایاس | 79-91-4 |
تعداد کمیسیون اروپایی | 201-233-2 |
ساختار مولکولی | ![]() |
نقطه ذوب | 175-180℃ |
نقطه غلیان | 347.6°C at 760 mmHg |
نقطه اشتعال | 148.6°C |
فشار بخار | 9.29E-06mmHg at 25°C |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |