ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2،4-دی متیل-6- (1-methylcyclohexyl) فنل؛ Lowinox (rg WSL؛ 6- (1-Methylcyclohexyl) -2،4-xylenol؛ |
|
نام محصول | 2،4-دی متیل-6- (1-methylcyclohexyl) فنل؛ Lowinox (rg WSL؛ 6- (1-Methylcyclohexyl) -2،4-xylenol؛ |
نام انگلیسی | 2,4-Dimethyl-6-(1-methylcyclohexyl)phenol;Lowinox(rg WSL;6-(1-Methylcyclohexyl)-2,4-xylenol |
میدان مغناطیسی | C15H22O |
وزن مولکولی | 218.3346 |
InChI | InChI=1/C15H22O/c1-11-9-12(2)14(16)13(10-11)15(3)7-5-4-6-8-15/h9-10,16H,4-8H2,1-3H3 |
شماره سیایاس | 77-61-2 |
تعداد کمیسیون اروپایی | 201-042-4 |
ساختار مولکولی | |
تراکم | 0.992g/cm3 |
نقطه غلیان | 311°C at 760 mmHg |
ضریب شکست | 1.532 |
نقطه اشتعال | 140°C |
فشار بخار | 0.000317mmHg at 25°C |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.||R43##May cause sensitization by skin contact.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |