ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
75-27-4 Bromodichloromethane |
|
نام محصول | Bromodichloromethane |
نام انگلیسی | Bromodichloromethane;FC-20B1 |
میدان مغناطیسی | CHBrCl2 |
وزن مولکولی | 163.8286 |
InChI | InChI=1/CHBrCl2/c2-1(3)4/h1H |
شماره سیایاس | 75-27-4 |
تعداد کمیسیون اروپایی | 200-856-7 |
ساختار مولکولی | ![]() |
تراکم | 2.013g/cm3 |
نقطه ذوب | -55℃ |
نقطه غلیان | 89.7°C at 760 mmHg |
ضریب شکست | 1.503 |
نقطه اشتعال | 1.3°C |
فشار بخار | 65.3mmHg at 25°C |
خطر نمادها | |
کدهای خطر | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
توضیحات ایمنی | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |