ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4,4'-Dimethoxybenzhydrol |
|
نام محصول | 4,4'-Dimethoxybenzhydrol |
نام انگلیسی | 4,4'-Dimethoxybenzhydrol;Bis(4-methoxyphenyl) carbinol;4,4-Dimethoxydiphenylmethanol;4,4-Dimethoxybenzhydrol;Bis(4-methoxyphenyl)carbinol;bis(4-methoxyphenyl)methanol |
میدان مغناطیسی | C15H16O3 |
وزن مولکولی | 244.2857 |
InChI | InChI=1/C15H16O3/c1-17-13-7-3-11(4-8-13)15(16)12-5-9-14(18-2)10-6-12/h3-10,15-16H,1-2H3 |
شماره سیایاس | 728-87-0 |
تعداد کمیسیون اروپایی | 211-975-9 |
ساختار مولکولی | |
تراکم | 1.135g/cm3 |
نقطه ذوب | 68-72℃ |
نقطه غلیان | 406.5°C at 760 mmHg |
ضریب شکست | 1.568 |
نقطه اشتعال | 199.6°C |
فشار بخار | 2.46E-07mmHg at 25°C |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |