ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1-phenylisatin |
|
نام محصول | 1-phenylisatin |
نام انگلیسی | 1-phenylisatin;1H-Indole-2,3-dione, 1-phenyl- (9CI);1-Phenyl-1H-indole-2,3-dione;1-Phenyl-indole-2,3-dione;1-Phenylisatin;5-21-10-00247 (Beilstein Handbook Reference);BRN 0164531;NSC 100013;Indole-2,3-dione, 1-phenyl- |
میدان مغناطیسی | C14H9NO2 |
وزن مولکولی | 223.2268 |
InChI | InChI=1/C14H9NO2/c16-13-11-8-4-5-9-12(11)15(14(13)17)10-6-2-1-3-7-10/h1-9H |
شماره سیایاس | 723-89-7 |
ساختار مولکولی | |
تراکم | 1.338g/cm3 |
نقطه ذوب | 138-140℃ |
نقطه غلیان | 388.8°C at 760 mmHg |
ضریب شکست | 1.667 |
نقطه اشتعال | 182.6°C |
فشار بخار | 2.99E-06mmHg at 25°C |
توضیحات ایمنی | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |