ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Methyl 4-biphenylcarboxylate |
|
نام محصول | Methyl 4-biphenylcarboxylate |
نام انگلیسی | Methyl 4-biphenylcarboxylate;P-phenylbenzoic acid methyl ester;p-Phenylbenzoic acid-OMe;Methyl 4-Phenylbenzoate;4-Biphenylcarboxylic acid methyl ester~Methyl 4-phenylbenzoate;methyl biphenyl-4-carboxylate;methyl 4-phenylcyclohexanecarboxylate |
میدان مغناطیسی | C14H18O2 |
وزن مولکولی | 218.2915 |
InChI | InChI=1/C14H18O2/c1-16-14(15)13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3 |
شماره سیایاس | 720-75-2 |
تعداد کمیسیون اروپایی | 211-954-4 |
ساختار مولکولی | |
تراکم | 1.048g/cm3 |
نقطه ذوب | 118℃ |
نقطه غلیان | 307.8°C at 760 mmHg |
ضریب شکست | 1.517 |
نقطه اشتعال | 132.7°C |
فشار بخار | 0.000709mmHg at 25°C |
توضیحات ایمنی | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |