ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,2-Bis(4-chlorophenyl)-1,1-dichloroethane |
|
نام محصول | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane |
نام انگلیسی | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane; |
میدان مغناطیسی | C14H10Cl4 |
وزن مولکولی | 320.04 |
InChI | InChI=1/C14H10Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8,13-14H |
شماره سیایاس | 72-54-8 |
تعداد کمیسیون اروپایی | 200-783-0 |
ساختار مولکولی | |
نقطه ذوب | 109-111℃ |
خطر نمادها | T##Toxic:; |
کدهای خطر | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
توضیحات ایمنی | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |