ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
6-Nitropiperonal |
|
نام محصول | 6-Nitropiperonal |
نام انگلیسی | 6-Nitropiperonal;(3,4-Methylenedioxy-6-nitrobenzald;4,5-Methylenedioxy-2-nitrobenzaldehyde;6-Nitro-1,3-benzodioxole-5-carboxaldehyde;6-nitro-1,3-benzodioxole-5-carbaldehyde;4,5-(Methylenedioxy)-2-nitrobenzaldehyde |
میدان مغناطیسی | C8H5NO5 |
وزن مولکولی | 195.129 |
InChI | InChI=1/C8H5NO5/c10-3-5-1-7-8(14-4-13-7)2-6(5)9(11)12/h1-3H,4H2 |
شماره سیایاس | 712-97-0 |
تعداد کمیسیون اروپایی | 211-926-1 |
ساختار مولکولی | |
تراکم | 1.572g/cm3 |
نقطه ذوب | 93-96℃ |
نقطه غلیان | 365.9°C at 760 mmHg |
ضریب شکست | 1.658 |
نقطه اشتعال | 195°C |
فشار بخار | 1.52E-05mmHg at 25°C |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |