ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Hydroxy-6-methoxyacetophenone |
|
نام محصول | 2-Hydroxy-6-methoxyacetophenone |
نام انگلیسی | 2-Hydroxy-6-methoxyacetophenone;1-(2-Hydroxy-6-methoxyphenyl)ethan-1-one;1-(2-hydroxy-6-methoxyphenyl)ethanone;2'-Hydroxy-6'-methoxyacetophenone |
میدان مغناطیسی | C9H10O3 |
وزن مولکولی | 166.1739 |
InChI | InChI=1/C9H10O3/c1-6(10)9-7(11)4-3-5-8(9)12-2/h3-5,11H,1-2H3 |
شماره سیایاس | 703-23-1 |
تعداد کمیسیون اروپایی | 211-872-9 |
ساختار مولکولی | |
تراکم | 1.158g/cm3 |
نقطه ذوب | 58-60℃ |
نقطه غلیان | 259.5°C at 760 mmHg |
ضریب شکست | 1.537 |
نقطه اشتعال | 108.1°C |
فشار بخار | 0.00798mmHg at 25°C |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |