ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Alpha-Ethylphenethyl alcohol |
|
نام محصول | Alpha-Ethylphenethyl alcohol |
نام انگلیسی | Alpha-Ethylphenethyl alcohol;1-Phenyl-2-butanol;1-phenylbutan-2-ol;(2S)-1-phenylbutan-2-ol;(2R)-1-phenylbutan-2-ol |
میدان مغناطیسی | C10H14O |
وزن مولکولی | 150.2176 |
InChI | InChI=1/C10H14O/c1-2-10(11)8-9-6-4-3-5-7-9/h3-7,10-11H,2,8H2,1H3/t10-/m1/s1 |
شماره سیایاس | 701-70-2 |
تعداد کمیسیون اروپایی | 211-858-2 |
ساختار مولکولی | |
تراکم | 0.98g/cm3 |
نقطه غلیان | 226.6°C at 760 mmHg |
ضریب شکست | 1.52 |
نقطه اشتعال | 100°C |
فشار بخار | 0.0459mmHg at 25°C |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |