ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4'-Aminopropiophenone |
|
نام محصول | 4'-Aminopropiophenone |
نام انگلیسی | 4'-Aminopropiophenone;4-Aminopropiophenone;para-Aminopropiophenone;p-Aminopropiophenone |
میدان مغناطیسی | C9H11NO |
وزن مولکولی | 149.1897 |
InChI | InChI=1/C9H11NO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3 |
شماره سیایاس | 70-69-9 |
تعداد کمیسیون اروپایی | 200-742-7 |
ساختار مولکولی | |
تراکم | 1.067g/cm3 |
نقطه ذوب | 137-143℃ |
نقطه غلیان | 305.8°C at 760 mmHg |
ضریب شکست | 1.559 |
نقطه اشتعال | 138.7°C |
فشار بخار | 0.000805mmHg at 25°C |
خطر نمادها | T##Toxic:; |
کدهای خطر | R25##Toxic if swallowed.:; |
توضیحات ایمنی | S28A##After contact with skin, wash immediately with plenty of water.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |