ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
66424-91-7 5-Methyl-2-nitrobenzyl chloride |
|
نام محصول | 5-Methyl-2-nitrobenzyl chloride |
نام انگلیسی | 5-Methyl-2-nitrobenzyl chloride;alpha-chloro-5-methyl-2-nitrotoluene;2-(chloromethyl)-4-methyl-1-nitrobenzene |
میدان مغناطیسی | C8H8ClNO2 |
وزن مولکولی | 185.6076 |
InChI | InChI=1/C8H8ClNO2/c1-6-2-3-8(10(11)12)7(4-6)5-9/h2-4H,5H2,1H3 |
شماره سیایاس | 66424-91-7 |
تعداد کمیسیون اروپایی | 266-359-2 |
ساختار مولکولی | |
تراکم | 1.277g/cm3 |
نقطه ذوب | 41-43℃ |
نقطه غلیان | 292.3°C at 760 mmHg |
ضریب شکست | 1.566 |
نقطه اشتعال | 130.6°C |
فشار بخار | 0.00324mmHg at 25°C |
خطر نمادها | C##Corrosive:; |
کدهای خطر | R34##Causes burns.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |