ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
o-Tolyl benzoate |
|
نام محصول | o-Tolyl benzoate |
نام انگلیسی | o-Tolyl benzoate;o-Tolyl benzoate (Benzoic acid o-tolyl ester);Benzoic acid o-tolyl ester;2-methylphenyl benzoate |
میدان مغناطیسی | C14H12O2 |
وزن مولکولی | 212.2439 |
InChI | InChI=1/C14H12O2/c1-11-7-5-6-10-13(11)16-14(15)12-8-3-2-4-9-12/h2-10H,1H3 |
شماره سیایاس | 617-02-7 |
تعداد کمیسیون اروپایی | 210-501-8 |
ساختار مولکولی | |
تراکم | 1.122g/cm3 |
نقطه غلیان | 368.9°C at 760 mmHg |
ضریب شکست | 1.577 |
نقطه اشتعال | 154.5°C |
فشار بخار | 1.23E-05mmHg at 25°C |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |