ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
613-13-8 2-Aminoanthracene |
|
نام محصول | 2-Aminoanthracene |
نام انگلیسی | 2-Aminoanthracene;2-anthramine practical grade*crystalline;2-anthrylamine;2-Anthramine;2-Anthranamine;anthracen-2-amine;2-Anthracenamide; |
میدان مغناطیسی | C14H11N |
وزن مولکولی | 193.2438 |
InChI | InChI=1/C14H11N/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H,15H2 |
شماره سیایاس | 613-13-8 |
تعداد کمیسیون اروپایی | 210-330-9 |
ساختار مولکولی | |
تراکم | 1.208g/cm3 |
نقطه ذوب | 238-241℃ |
نقطه غلیان | 414.2°C at 760 mmHg |
ضریب شکست | 1.765 |
نقطه اشتعال | 229°C |
فشار بخار | 4.52E-07mmHg at 25°C |
خطر نمادها | Xn##Harmful:; |
کدهای خطر | R33##Danger of cummulative effects.:; |
توضیحات ایمنی | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |