ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Methylanthracene |
|
نام محصول | 2-Methylanthracene |
نام انگلیسی | 2-Methylanthracene;CCRIS 2739;NSC 87376;Anthracene, 2-methyl- |
میدان مغناطیسی | C15H12 |
وزن مولکولی | 192.2558 |
InChI | InChI=1/C15H12/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13/h2-10H,1H3 |
شماره سیایاس | 613-12-7 |
تعداد کمیسیون اروپایی | 210-329-3 |
ساختار مولکولی | |
تراکم | 1.105g/cm3 |
نقطه ذوب | 202-206℃ |
نقطه غلیان | 347.2°C at 760 mmHg |
ضریب شکست | 1.693 |
نقطه اشتعال | 157.5°C |
فشار بخار | 0.00011mmHg at 25°C |
خطر نمادها | Xn##Harmful:; |
کدهای خطر | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |