ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
612-28-2 N-Methyl-2-nitroaniline |
|
نام محصول | N-Methyl-2-nitroaniline |
نام انگلیسی | N-Methyl-2-nitroaniline;Benzenamine, N-methyl-2-nitro-;2-Nitro-N-methylaniline;4-12-00-01564 (Beilstein Handbook Reference);Aniline, N-methyl-o-nitro-;BRN 2209110;N-Methyl-2-nitrobenzenamine;N-Methyl-o-nitroaniline;NSC 86672;o-(Methylamino)nitrobenzene;o-Nitro-N-methylaniline |
میدان مغناطیسی | C7H8N2O2 |
وزن مولکولی | 152.1506 |
InChI | InChI=1/C7H8N2O2/c1-8-6-4-2-3-5-7(6)9(10)11/h2-5,8H,1H3 |
شماره سیایاس | 612-28-2 |
تعداد کمیسیون اروپایی | 210-303-1 |
ساختار مولکولی | ![]() |
تراکم | 1.26g/cm3 |
نقطه ذوب | 33-37℃ |
نقطه غلیان | 277.9°C at 760 mmHg |
ضریب شکست | 1.619 |
نقطه اشتعال | 121.9°C |
فشار بخار | 0.0044mmHg at 25°C |
خطر نمادها | |
کدهای خطر | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.:; |
توضیحات ایمنی | S28A##After contact with skin, wash immediately with plenty of water.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |