ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Nitrobenzyl chloride |
|
نام محصول | 2-Nitrobenzyl chloride |
نام انگلیسی | 2-Nitrobenzyl chloride;alpha-Chloro-2-nitrotoluene;a-Chloro-2-nitrotoluene);1-chloro-2-methyl-3-nitrobenzene;1-(chloromethyl)-2-nitrobenzene |
میدان مغناطیسی | C7H6ClNO2 |
وزن مولکولی | 171.581 |
InChI | InChI=1/C7H6ClNO2/c8-5-6-3-1-2-4-7(6)9(10)11/h1-4H,5H2 |
شماره سیایاس | 612-23-7 |
تعداد کمیسیون اروپایی | 210-300-5 |
ساختار مولکولی | |
تراکم | 1.33g/cm3 |
نقطه ذوب | 46-50℃ |
نقطه غلیان | 269°C at 760 mmHg |
ضریب شکست | 1.574 |
نقطه اشتعال | 112.7°C |
فشار بخار | 0.0123mmHg at 25°C |
خطر نمادها | C##Corrosive:; |
کدهای خطر | R34##Causes burns.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |