ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
611-79-0 3,3'-Diaminobenzophenone |
|
نام محصول | 3,3'-Diaminobenzophenone |
نام انگلیسی | 3,3'-Diaminobenzophenone;bis(3-aminophenyl)methanone |
میدان مغناطیسی | C13H12N2O |
وزن مولکولی | 212.2472 |
InChI | InChI=1/C13H12N2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H,14-15H2 |
شماره سیایاس | 611-79-0 |
تعداد کمیسیون اروپایی | 210-281-3 |
ساختار مولکولی | ![]() |
تراکم | 1.233g/cm3 |
نقطه غلیان | 469.4°C at 760 mmHg |
ضریب شکست | 1.673 |
نقطه اشتعال | 237.7°C |
فشار بخار | 5.51E-09mmHg at 25°C |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |