ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
605-62-9 4-Nitro-1-Naphthol |
|
نام محصول | 4-Nitro-1-Naphthol |
نام انگلیسی | 4-Nitro-1-Naphthol;4-nitronaphthalen-1-ol |
میدان مغناطیسی | C10H7NO3 |
وزن مولکولی | 189.1675 |
InChI | InChI=1/C10H7NO3/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-6,12H |
شماره سیایاس | 605-62-9 |
ساختار مولکولی | |
تراکم | 1.413g/cm3 |
نقطه غلیان | 398.8°C at 760 mmHg |
ضریب شکست | 1.714 |
نقطه اشتعال | 179.8°C |
فشار بخار | 6.25E-07mmHg at 25°C |
کدهای خطر | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
توضیحات ایمنی | S28##After contact with skin, wash immediately with plenty of ...||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |