ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3-Hydroxy-2-nitrobenzoic acid |
|
نام محصول | 3-Hydroxy-2-nitrobenzoic acid |
نام انگلیسی | 3-Hydroxy-2-nitrobenzoic acid; |
میدان مغناطیسی | C7H5NO5 |
وزن مولکولی | 183.1183 |
InChI | InChI=1/C7H5NO5/c9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-3,9H,(H,10,11) |
شماره سیایاس | 602-00-6 |
ساختار مولکولی | |
تراکم | 1.631g/cm3 |
نقطه غلیان | 362.9°C at 760 mmHg |
ضریب شکست | 1.663 |
نقطه اشتعال | 166.7°C |
فشار بخار | 6.68E-06mmHg at 25°C |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |