ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Isopropylmalonic acid |
|
نام محصول | Isopropylmalonic acid |
نام انگلیسی | Isopropylmalonic acid;isopropyl malonic acid;propan-2-ylpropanedioic acid;(1-methylethyl)propanedioate |
میدان مغناطیسی | C6H8O4 |
وزن مولکولی | 144.1264 |
InChI | InChI=1/C6H10O4/c1-3(2)4(5(7)8)6(9)10/h3-4H,1-2H3,(H,7,8)(H,9,10)/p-2 |
شماره سیایاس | 601-79-6 |
تعداد کمیسیون اروپایی | 210-008-8 |
ساختار مولکولی | |
نقطه غلیان | 315.4°C at 760 mmHg |
نقطه اشتعال | 158.7°C |
فشار بخار | 9.44E-05mmHg at 25°C |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |