ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54-88-6 4-Dimethylamino-2-methylazobenzene؛ ؛ N، N-دی متیل-4-فنیلازو-m-toluidine؛ N، N، 3-trimethyl-4- [(E) -فنیل دیازنیل]انیلین؛ |
|
نام محصول | 4-Dimethylamino-2-methylazobenzene؛ ؛ N، N-دی متیل-4-فنیلازو-m-toluidine؛ N، N، 3-trimethyl-4- [(E) -فنیل دیازنیل]انیلین؛ |
نام انگلیسی | 4-Dimethylamino-2-methylazobenzene;N,N-Dimethyl-4-phenylazo-m-toluidine;N,N,3-trimethyl-4-[(E)-phenyldiazenyl]aniline |
میدان مغناطیسی | C15H17N3 |
وزن مولکولی | 239.3156 |
InChI | InChI=1/C15H17N3/c1-12-11-14(18(2)3)9-10-15(12)17-16-13-7-5-4-6-8-13/h4-11H,1-3H3/b17-16+ |
شماره سیایاس | 54-88-6 |
تعداد کمیسیون اروپایی | 200-217-2 |
ساختار مولکولی | ![]() |
تراکم | 1.01g/cm3 |
نقطه ذوب | 65-68℃ |
نقطه غلیان | 390.9°C at 760 mmHg |
ضریب شکست | 1.561 |
نقطه اشتعال | 190.2°C |
فشار بخار | 2.57E-06mmHg at 25°C |
خطر نمادها | |
کدهای خطر | R23/24##Toxic by inhalation and in contact with skin.||R33##Danger of cummulative effects.:; |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |