ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
539-44-6 p-tolylhydrazine |
|
نام محصول | p-tolylhydrazine |
نام انگلیسی | p-tolylhydrazine;4-Methylphenylhydrazine;(4-methylphenyl)hydrazine hydrochloride (1:1) |
میدان مغناطیسی | C7H11ClN2 |
وزن مولکولی | 158.6286 |
InChI | InChI=1/C7H10N2.ClH/c1-6-2-4-7(9-8)5-3-6;/h2-5,9H,8H2,1H3;1H |
شماره سیایاس | 539-44-6 |
تعداد کمیسیون اروپایی | 208-717-2 |
ساختار مولکولی | |
نقطه غلیان | 242.8°C at 760 mmHg |
نقطه اشتعال | 115.3°C |
فشار بخار | 0.0333mmHg at 25°C |
کدهای خطر | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |