ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52605-96-6 2-Chloro-3-methoxypyridine |
|
نام محصول | 2-Chloro-3-methoxypyridine |
نام انگلیسی | 2-Chloro-3-methoxypyridine; |
میدان مغناطیسی | C6H6ClNO |
وزن مولکولی | 143.5709 |
InChI | InChI=1/C6H6ClNO/c1-9-5-3-2-4-8-6(5)7/h2-4H,1H3 |
شماره سیایاس | 52605-96-6 |
تعداد کمیسیون اروپایی | 258-039-6 |
ساختار مولکولی | |
تراکم | 1.21g/cm3 |
نقطه غلیان | 210.6°C at 760 mmHg |
ضریب شکست | 1.517 |
نقطه اشتعال | 81.2°C |
فشار بخار | 0.276mmHg at 25°C |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |