ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
513-92-8 tetraiodoethylene |
|
نام محصول | tetraiodoethylene |
نام انگلیسی | tetraiodoethylene;diiodoform;tetraiodoethene |
میدان مغناطیسی | C2I4 |
وزن مولکولی | 531.6393 |
InChI | InChI=1/C2I4/c3-1(4)2(5)6 |
شماره سیایاس | 513-92-8 |
تعداد کمیسیون اروپایی | 208-176-2 |
ساختار مولکولی | ![]() |
تراکم | 4.087g/cm3 |
نقطه ذوب | 191-193℃ |
نقطه غلیان | 288.3°C at 760 mmHg |
ضریب شکست | 1.952 |
نقطه اشتعال | 139.9°C |
فشار بخار | 0.00409mmHg at 25°C |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |