ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
D-Thyroxine |
|
نام محصول | D-Thyroxine |
نام انگلیسی | D-Thyroxine;D-4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodobenzylalanine;D-thyroxine free acid;O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodotyrosine;O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-D-tyrosine |
میدان مغناطیسی | C16H13I4NO4 |
وزن مولکولی | 790.8966 |
InChI | InChI=1/C16H13I4NO4/c1-7(16(23)24)21-6-8-2-12(19)15(13(20)3-8)25-9-4-10(17)14(22)11(18)5-9/h2-5,7,21-22H,6H2,1H3,(H,23,24)/t7-/m1/s1 |
شماره سیایاس | 51-49-0 |
تعداد کمیسیون اروپایی | 200-102-7 |
ساختار مولکولی | |
نقطه ذوب | 225℃ |
ضریب شکست | 1.759 |
خطر نمادها | Xn##Harmful:; |
کدهای خطر | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |