ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50-66-8 6-(Methylthio)purine |
|
نام محصول | 6-(Methylthio)purine |
نام انگلیسی | 6-(Methylthio)purine;6-(Methylmercapto)purine;6-(Methylsulfanyl)-9H-purine;6-(methylsulfanyl)-7H-purine;6-(methylsulfanyl)-5H-purine |
میدان مغناطیسی | C6H6N4S |
وزن مولکولی | 166.2036 |
InChI | InChI=1/C6H6N4S/c1-11-6-4-5(8-2-7-4)9-3-10-6/h2-4H,1H3 |
شماره سیایاس | 50-66-8 |
تعداد کمیسیون اروپایی | 200-057-3 |
ساختار مولکولی | ![]() |
تراکم | 1.59g/cm3 |
نقطه ذوب | 221-222℃ |
نقطه غلیان | 290.9°C at 760 mmHg |
ضریب شکست | 1.806 |
نقطه اشتعال | 129.7°C |
فشار بخار | 0.00351mmHg at 25°C |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |