ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4707-46-4 2,4-Dihydroxy-3,6-dimethylbenzoic acid |
|
نام محصول | 2,4-Dihydroxy-3,6-dimethylbenzoic acid |
نام انگلیسی | 2,4-Dihydroxy-3,6-dimethylbenzoic acid;3,6-Dimethyl-2,4-dihydroxybenzoic acid |
میدان مغناطیسی | C9H10O4 |
وزن مولکولی | 182.1733 |
InChI | InChI=1/C9H10O4/c1-4-3-6(10)5(2)8(11)7(4)9(12)13/h3,10-11H,1-2H3,(H,12,13) |
شماره سیایاس | 4707-46-4 |
ساختار مولکولی | |
تراکم | 1.386g/cm3 |
نقطه غلیان | 407.4°C at 760 mmHg |
ضریب شکست | 1.627 |
نقطه اشتعال | 214.3°C |
فشار بخار | 2.29E-07mmHg at 25°C |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |