ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
465514-33-4 (2-مورفولینوفنیل) متانول؛ (2-مورفولین-4-یل فنیل) متانول؛ |
|
نام محصول | (2-مورفولینوفنیل) متانول؛ (2-مورفولین-4-یل فنیل) متانول؛ |
نام انگلیسی | (2-morpholinophenyl)methanol;(2-morpholin-4-ylphenyl)methanol |
میدان مغناطیسی | C11H15NO2 |
وزن مولکولی | 193.2423 |
InChI | InChI=1/C11H15NO2/c13-9-10-3-1-2-4-11(10)12-5-7-14-8-6-12/h1-4,13H,5-9H2 |
شماره سیایاس | 465514-33-4 |
ساختار مولکولی | |
تراکم | 1.16g/cm3 |
نقطه ذوب | 54℃ |
نقطه غلیان | 362.8°C at 760 mmHg |
ضریب شکست | 1.568 |
نقطه اشتعال | 173.2°C |
فشار بخار | 6.7E-06mmHg at 25°C |
خطر نمادها | Xi##Irritant:; |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |