ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,4-ethylfluorobenzene |
|
نام محصول | 1,4-ethylfluorobenzene |
نام انگلیسی | 1,4-ethylfluorobenzene;1-Ethyl-4-fluorobenzene;benzene, 1-ethyl-4-fluoro-;Ethyl-4-fluorobenzene |
میدان مغناطیسی | C8H9F |
وزن مولکولی | 124.1555 |
InChI | InChI=1/C8H9F/c1-2-7-3-5-8(9)6-4-7/h3-6H,2H2,1H3 |
شماره سیایاس | 459-47-2 |
ساختار مولکولی | |
تراکم | 0.981g/cm3 |
نقطه غلیان | 141.6°C at 760 mmHg |
ضریب شکست | 1.477 |
نقطه اشتعال | 28.9°C |
فشار بخار | 7.26mmHg at 25°C |
کدهای خطر | R10##Flammable.:; |
توضیحات ایمنی | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |