ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
458-05-9 1-(3-fluorophenyl)-2-thiourea |
|
نام محصول | 1-(3-fluorophenyl)-2-thiourea |
نام انگلیسی | 1-(3-fluorophenyl)-2-thiourea;3-Fluorophenylthiourea;1-(3-fluorophenyl)thiourea |
میدان مغناطیسی | C7H7FN2S |
وزن مولکولی | 170.2073 |
InChI | InChI=1/C7H7FN2S/c8-5-2-1-3-6(4-5)10-7(9)11/h1-4H,(H3,9,10,11) |
شماره سیایاس | 458-05-9 |
ساختار مولکولی | |
تراکم | 1.397g/cm3 |
نقطه غلیان | 259.3°C at 760 mmHg |
ضریب شکست | 1.692 |
نقطه اشتعال | 110.6°C |
فشار بخار | 0.0131mmHg at 25°C |
کدهای خطر | R25##Toxic if swallowed.:; |
توضیحات ایمنی | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |