ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3-fluorobenzamide |
|
نام محصول | 3-fluorobenzamide |
نام انگلیسی | 3-fluorobenzamide;m-Fluorobenzamide |
میدان مغناطیسی | C7H6FNO |
وزن مولکولی | 139.127 |
InChI | InChI=1/C7H6FNO/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H2,9,10) |
شماره سیایاس | 455-37-8 |
تعداد کمیسیون اروپایی | 207-247-5 |
ساختار مولکولی | |
تراکم | 1.238g/cm3 |
نقطه ذوب | 129-132℃ |
نقطه غلیان | 238.4°C at 760 mmHg |
ضریب شکست | 1.538 |
نقطه اشتعال | 98°C |
فشار بخار | 0.0426mmHg at 25°C |
خطر نمادها | Xi##Irritant:; |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |