ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
DL-Homocysteine |
|
نام محصول | DL-Homocysteine |
نام انگلیسی | DL-Homocysteine;DL-Homocysteine 2-Amino-4-mercaptobuyric acid;homocysteine;D-homocysteine |
میدان مغناطیسی | C4H9NO2S |
وزن مولکولی | 135.1848 |
InChI | InChI=1/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7)/t3-/m1/s1 |
شماره سیایاس | 454-29-5 |
تعداد کمیسیون اروپایی | 207-222-9 |
ساختار مولکولی | |
تراکم | 1.259g/cm3 |
نقطه ذوب | 232-233℃ |
نقطه غلیان | 299.7°C at 760 mmHg |
ضریب شکست | 1.537 |
نقطه اشتعال | 135°C |
فشار بخار | 0.000278mmHg at 25°C |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |