ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1-Chloro-3-fluoro-2-propanol |
|
نام محصول | 1-Chloro-3-fluoro-2-propanol |
نام انگلیسی | 1-Chloro-3-fluoro-2-propanol;1-Chloro-3-fluoroisopropanol;1-chloro-3-fluoropropan-2-ol |
میدان مغناطیسی | C3H6ClFO |
وزن مولکولی | 112.5305 |
InChI | InChI=1/C3H6ClFO/c4-1-3(6)2-5/h3,6H,1-2H2 |
شماره سیایاس | 453-11-2 |
ساختار مولکولی | |
تراکم | 1.212g/cm3 |
نقطه غلیان | 158.1°C at 760 mmHg |
ضریب شکست | 1.399 |
نقطه اشتعال | 49.4°C |
فشار بخار | 0.951mmHg at 25°C |
کدهای خطر | R10##Flammable.||R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
توضیحات ایمنی | S23##Do not inhale gas/fumes/vapour/spray.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |