ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4521-31-7 2-Mercaptobenzyl alcohol |
|
نام محصول | 2-Mercaptobenzyl alcohol |
نام انگلیسی | 2-Mercaptobenzyl alcohol;2-(Hydroxymethyl)thiophenol;O-Mercaptobenzyl alcohol;(2-Sulfanylphenyl)methanol;2- Mercaptobenzyl alcohol, tech. ;2-(hydroxymethyl)benzenethiolate |
میدان مغناطیسی | C7H7OS |
وزن مولکولی | 139.1954 |
InChI | InChI=1/C7H8OS/c8-5-6-3-1-2-4-7(6)9/h1-4,8-9H,5H2/p-1 |
شماره سیایاس | 4521-31-7 |
ساختار مولکولی | |
نقطه ذوب | 31-32℃ |
نقطه غلیان | 276.5°C at 760 mmHg |
نقطه اشتعال | 121°C |
فشار بخار | 0.00231mmHg at 25°C |
کدهای خطر | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/38##Irritating to eyes and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |