ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Bromo-5-fluoronitrobenzene |
|
نام محصول | 2-Bromo-5-fluoronitrobenzene |
نام انگلیسی | 2-Bromo-5-fluoronitrobenzene;1-Bromo-4-fluoro-2-nitrobenzene |
میدان مغناطیسی | C6H3BrFNO2 |
وزن مولکولی | 219.9959 |
InChI | InChI=1/C6H3BrFNO2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H |
شماره سیایاس | 446-09-3 |
تعداد کمیسیون اروپایی | 207-160-2 |
ساختار مولکولی | |
تراکم | 1.808g/cm3 |
نقطه ذوب | 37-39℃ |
نقطه غلیان | 220.9°C at 760 mmHg |
ضریب شکست | 1.579 |
نقطه اشتعال | 87.4°C |
فشار بخار | 0.164mmHg at 25°C |
کدهای خطر | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |