ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Chloro-6-fluorobenzaldoxime |
|
نام محصول | 2-Chloro-6-fluorobenzaldoxime |
نام انگلیسی | 2-Chloro-6-fluorobenzaldoxime;2-Chloro-6-fluorobenzaldehyde oxime |
میدان مغناطیسی | C7H5ClFNO |
وزن مولکولی | 173.5721 |
InChI | InChI=1/C7H5ClFNO/c8-6-2-1-3-7(9)5(6)4-10-11/h1-4,11H |
شماره سیایاس | 443-33-4 |
تعداد کمیسیون اروپایی | 207-135-6 |
ساختار مولکولی | |
تراکم | 1.32g/cm3 |
نقطه ذوب | 133℃ |
نقطه غلیان | 238°C at 760 mmHg |
ضریب شکست | 1.533 |
نقطه اشتعال | 97.8°C |
فشار بخار | 0.0237mmHg at 25°C |
خطر نمادها | Xi##Irritant:; |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |