ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-Fluoro-3-methylbenzoic acid |
|
نام محصول | 4-Fluoro-3-methylbenzoic acid |
نام انگلیسی | 4-Fluoro-3-methylbenzoic acid;4-Fluoro-m-toluic acid;4-fluoro-3-methylbenzoate;3-methyl-4-Fluorobenzoic acid; |
میدان مغناطیسی | C8H6FO2 |
وزن مولکولی | 153.131 |
InChI | InChI=1/C8H7FO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,1H3,(H,10,11)/p-1 |
شماره سیایاس | 403-15-6 |
ساختار مولکولی | |
نقطه ذوب | 166-169℃ |
نقطه غلیان | 266.3°C at 760 mmHg |
نقطه اشتعال | 114.9°C |
فشار بخار | 0.00434mmHg at 25°C |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |