ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1-(3-fluorophenyl)ethanol |
|
نام محصول | 1-(3-fluorophenyl)ethanol |
نام انگلیسی | 1-(3-fluorophenyl)ethanol;3-fluorophenyl methyl carbinol;3-Fluoro-alpha-methylbenzyl alcohol~3-Fluorophenyl methyl carbinol;3-Fluoro-α-methylbenzenemethanol |
میدان مغناطیسی | C8H9FO |
وزن مولکولی | 140.1549 |
InChI | InChI=1/C8H9FO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3 |
شماره سیایاس | 402-63-1 |
تعداد کمیسیون اروپایی | 206-950-4 |
ساختار مولکولی | |
تراکم | 1.123g/cm3 |
نقطه غلیان | 196.2°C at 760 mmHg |
ضریب شکست | 1.51 |
نقطه اشتعال | 90.1°C |
فشار بخار | 0.251mmHg at 25°C |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |