ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39978-14-8 Methyl 3-aminothiophene-4-carboxylate hydrochloride |
|
نام محصول | Methyl 3-aminothiophene-4-carboxylate hydrochloride |
نام انگلیسی | Methyl 3-aminothiophene-4-carboxylate hydrochloride;methyl 4-aminothiophene-3-carboxylate hydrochloride;methyl 4-aminothiophene-3-carboxylate |
میدان مغناطیسی | C6H7NO2S |
وزن مولکولی | 157.1903 |
InChI | InChI=1/C6H7NO2S/c1-9-6(8)4-2-10-3-5(4)7/h2-3H,7H2,1H3 |
شماره سیایاس | 39978-14-8 |
ساختار مولکولی | |
تراکم | 1.319g/cm3 |
نقطه ذوب | 203℃ |
نقطه غلیان | 295.9°C at 760 mmHg |
ضریب شکست | 1.598 |
نقطه اشتعال | 132.8°C |
فشار بخار | 0.00148mmHg at 25°C |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |