ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
388088-83-3 2-bromo-1- (3،5-dimethyl-1-benzothiophen-2-yl) -1-اتانون؛ 2-bromo-1- (3،5-dimethyl-1-benzothiophen-2-yl) اتانون؛ |
|
نام محصول | 2-bromo-1- (3،5-dimethyl-1-benzothiophen-2-yl) -1-اتانون؛ 2-bromo-1- (3،5-dimethyl-1-benzothiophen-2-yl) اتانون؛ |
نام انگلیسی | 2-bromo-1-(3,5-dimethyl-1-benzothiophen-2-yl)-1-ethanone;2-bromo-1-(3,5-dimethyl-1-benzothiophen-2-yl)ethanone |
میدان مغناطیسی | C12H11BrOS |
وزن مولکولی | 283.1841 |
InChI | InChI=1/C12H11BrOS/c1-7-3-4-11-9(5-7)8(2)12(15-11)10(14)6-13/h3-5H,6H2,1-2H3 |
شماره سیایاس | 388088-83-3 |
ساختار مولکولی | ![]() |
تراکم | 1.488g/cm3 |
نقطه ذوب | 125℃ |
نقطه غلیان | 378.5°C at 760 mmHg |
ضریب شکست | 1.655 |
نقطه اشتعال | 182.7°C |
فشار بخار | 6.26E-06mmHg at 25°C |
خطر نمادها | |
کدهای خطر | R34##Causes burns.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |