ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
37551-43-2 5-chloro-N,2-dihydroxybenzamide |
|
نام محصول | 5-chloro-N,2-dihydroxybenzamide |
نام انگلیسی | 5-chloro-N,2-dihydroxybenzamide;5-Chloro-N,2-dihydrobenzamide |
میدان مغناطیسی | C7H6ClNO3 |
وزن مولکولی | 187.5804 |
InChI | InChI=1/C7H6ClNO3/c8-4-1-2-6(10)5(3-4)7(11)9-12/h1-3,10,12H,(H,9,11) |
شماره سیایاس | 37551-43-2 |
تعداد کمیسیون اروپایی | 253-550-0 |
ساختار مولکولی | |
تراکم | 1.548g/cm3 |
نقطه ذوب | 208℃ |
ضریب شکست | 1.638 |
خطر نمادها | Xi##Irritant:; |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |