ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
36919-03-6 Methyl pentafluorophenyl carbonate |
|
نام محصول | Methyl pentafluorophenyl carbonate |
نام انگلیسی | Methyl pentafluorophenyl carbonate;Pentafluorophenyl methyl carbonate |
میدان مغناطیسی | C8H3F5O3 |
وزن مولکولی | 242.0996 |
InChI | InChI=1/C8H3F5O3/c1-15-8(14)16-7-5(12)3(10)2(9)4(11)6(7)13/h1H3 |
شماره سیایاس | 36919-03-6 |
ساختار مولکولی | |
تراکم | 1.567g/cm3 |
نقطه غلیان | 207.5°C at 760 mmHg |
ضریب شکست | 1.422 |
نقطه اشتعال | 77.3°C |
فشار بخار | 0.224mmHg at 25°C |
کدهای خطر | R22##Harmful if swallowed.||R36/38##Irritating to eyes and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |