ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
35696-77-6 2,4-Dimethoxyphenylthiourea |
|
نام محصول | 2,4-Dimethoxyphenylthiourea |
نام انگلیسی | 2,4-Dimethoxyphenylthiourea;1-(2,4-DIMETHOXYPHENYL)-2-THIOUREA;1-(2,4-dimethoxyphenyl)thiourea |
میدان مغناطیسی | C9H12N2O2S |
وزن مولکولی | 212.2688 |
InChI | InChI=1/C9H12N2O2S/c1-12-6-3-4-7(11-9(10)14)8(5-6)13-2/h3-5H,1-2H3,(H3,10,11,14) |
شماره سیایاس | 35696-77-6 |
ساختار مولکولی | |
تراکم | 1.282g/cm3 |
نقطه غلیان | 352.5°C at 760 mmHg |
ضریب شکست | 1.645 |
نقطه اشتعال | 167°C |
فشار بخار | 3.83E-05mmHg at 25°C |
کدهای خطر | R25##Toxic if swallowed.:; |
توضیحات ایمنی | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |