ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-(trifluoromethylthio)aniline |
|
نام محصول | 2-(trifluoromethylthio)aniline |
نام انگلیسی | 2-(trifluoromethylthio)aniline;2-Aminophenyl trifluoromethyl sulphide;4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoic acid |
میدان مغناطیسی | C11H11FO4 |
وزن مولکولی | 226.201 |
InChI | InChI=1/C11H11FO4/c1-16-10-4-2-7(6-8(10)12)9(13)3-5-11(14)15/h2,4,6H,3,5H2,1H3,(H,14,15) |
شماره سیایاس | 347-55-7 |
تعداد کمیسیون اروپایی | 206-473-1 |
ساختار مولکولی | |
تراکم | 1.279g/cm3 |
نقطه غلیان | 422.6°C at 760 mmHg |
ضریب شکست | 1.52 |
نقطه اشتعال | 209.4°C |
فشار بخار | 6.78E-08mmHg at 25°C |
کدهای خطر | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
توضیحات ایمنی | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |