ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
345-70-0 3,3'-difluorobenzophenone |
|
نام محصول | 3,3'-difluorobenzophenone |
نام انگلیسی | 3,3'-difluorobenzophenone;bis(3-fluorophenyl)methanone |
میدان مغناطیسی | C13H8F2O |
وزن مولکولی | 218.1988 |
InChI | InChI=1/C13H8F2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H |
شماره سیایاس | 345-70-0 |
ساختار مولکولی | ![]() |
تراکم | 1.239g/cm3 |
نقطه ذوب | 56-59℃ |
نقطه غلیان | 316.2°C at 760 mmHg |
ضریب شکست | 1.549 |
نقطه اشتعال | 121.3°C |
فشار بخار | 0.000415mmHg at 25°C |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |