ChemIndex - یک پایگاه داده CAS شیمیایی رایگانChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
dimethyl fluoromalonate |
|
نام محصول | dimethyl fluoromalonate |
نام انگلیسی | dimethyl fluoromalonate;Fluoromalonic acid dimethyl ester;dimethyl fluoropropanedioate;2-Fluoro-malonic acid dimethyl ester |
میدان مغناطیسی | C5H7FO4 |
وزن مولکولی | 150.1051 |
InChI | InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
شماره سیایاس | 344-14-9 |
ساختار مولکولی | |
تراکم | 1.211g/cm3 |
نقطه غلیان | 140.3°C at 760 mmHg |
ضریب شکست | 1.382 |
نقطه اشتعال | 38.4°C |
فشار بخار | 6.18mmHg at 25°C |
کدهای خطر | R34##Causes burns.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |