ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
33904-04-0 3,4-Dimethoxyphenyl isothiocyanate |
|
نام محصول | 3,4-Dimethoxyphenyl isothiocyanate |
نام انگلیسی | 3,4-Dimethoxyphenyl isothiocyanate;3,4-Dimethoxyisothiocyanatobenzene;4-isothiocyanato-1,2-dimethoxybenzene |
میدان مغناطیسی | C9H9NO2S |
وزن مولکولی | 195.2383 |
InChI | InChI=1/C9H9NO2S/c1-11-8-4-3-7(10-6-13)5-9(8)12-2/h3-5H,1-2H3 |
شماره سیایاس | 33904-04-0 |
ساختار مولکولی | |
تراکم | 1.12g/cm3 |
نقطه ذوب | 47-172℃ |
نقطه غلیان | 311°C at 760 mmHg |
ضریب شکست | 1.537 |
نقطه اشتعال | 141.9°C |
فشار بخار | 0.00106mmHg at 25°C |
خطر نمادها | Xn##Harmful:; |
کدهای خطر | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |