ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
332121-92-3 2-(Fmoc-amino)-4-chlorobenzoic acid |
|
نام محصول | 2-(Fmoc-amino)-4-chlorobenzoic acid |
نام انگلیسی | 2-(Fmoc-amino)-4-chlorobenzoic acid;N-(9-Fluorenylmethoxycarbonyl)-4-chloroanthranilic acid~N-Fmoc-4-chloroanthranilic acid;4-chloro-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid |
میدان مغناطیسی | C22H16ClNO4 |
وزن مولکولی | 393.8197 |
InChI | InChI=1/C22H16ClNO4/c23-13-9-10-18(21(25)26)20(11-13)24-22(27)28-12-19-16-7-3-1-5-14(16)15-6-2-4-8-17(15)19/h1-11,19H,12H2,(H,24,27)(H,25,26) |
شماره سیایاس | 332121-92-3 |
ساختار مولکولی | ![]() |
تراکم | 1.418g/cm3 |
نقطه غلیان | 555.5°C at 760 mmHg |
ضریب شکست | 1.687 |
نقطه اشتعال | 289.8°C |
فشار بخار | 3.54E-13mmHg at 25°C |
کدهای خطر | R36/38##Irritating to eyes and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |